C13H16NO2+ — CID 27552272
4-methoxy-1,2,3-trimethylcyclohepta[c]pyrrol-2-ium-8-ol (PubChem CID 27552272) has the molecular formula C13H16NO2+ and a molecular weight of 218.28 g/mol. Its IUPAC name is 4-methoxy-1,2,3-trimethylcyclohepta[c]pyrrol-2-ium-8-ol.
| Compound Name | 4-methoxy-1,2,3-trimethylcyclohepta[c]pyrrol-2-ium-8-ol |
|---|---|
| PubChem CID | 27552272 |
| Molecular Formula | C13H16NO2+ |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 4-methoxy-1,2,3-trimethylcyclohepta[c]pyrrol-2-ium-8-ol |
| SMILES | COc1cccc(O)c2c(C)[n+](C)c(C)c1-2 |
| InChI | InChI=1S/C13H15NO2/c1-8-12-10(15)6-5-7-11(16-4)13(12)9(2)14(8)3/h5-7H,1-4H3/p+1 |
| InChIKey | NNDJOLZOKXFLEA-UHFFFAOYSA-O |
| XLogP | 1.95 |
| TPSA | 33.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|