C17H15BrN4O3S3 — CID 27558383
2-[4-amino-5-(5-bromothiophen-2-yl)sulfonylpyrimidin-2-yl]sulfanyl-N-benzylacetamide (PubChem CID 27558383) has the molecular formula C17H15BrN4O3S3 and a molecular weight of 499.44 g/mol. Its IUPAC name is 2-[4-amino-5-(5-bromothiophen-2-yl)sulfonylpyrimidin-2-yl]sulfanyl-N-benzylacetamide.
| Compound Name | 2-[4-amino-5-(5-bromothiophen-2-yl)sulfonylpyrimidin-2-yl]sulfanyl-N-benzylacetamide |
|---|---|
| PubChem CID | 27558383 |
| Molecular Formula | C17H15BrN4O3S3 |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 497.95 |
| IUPAC Name | 2-[4-amino-5-(5-bromothiophen-2-yl)sulfonylpyrimidin-2-yl]sulfanyl-N-benzylacetamide |
| SMILES | Nc1nc(SCC(=O)NCc2ccccc2)ncc1S(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C17H15BrN4O3S3/c18-13-6-7-15(27-13)28(24,25)12-9-21-17(22-16(12)19)26-10-14(23)20-8-11-4-2-1-3-5-11/h1-7,9H,8,10H2,(H,20,23)(H2,19,21,22) |
| InChIKey | LIVODYJWZWSLLB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |