C19H16ClF6N3O — CID 2765011
1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-[[3-(trifluoromethyl)phenyl]methoxy]piperidin-4-imine (PubChem CID 2765011) has the molecular formula C19H16ClF6N3O and a molecular weight of 451.80 g/mol. Its IUPAC name is 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-[[3-(trifluoromethyl)phenyl]methoxy]piperidin-4-imine.
| Compound Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-[[3-(trifluoromethyl)phenyl]methoxy]piperidin-4-imine |
|---|---|
| PubChem CID | 2765011 |
| Molecular Formula | C19H16ClF6N3O |
| Molecular Weight | 451.80 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-[[3-(trifluoromethyl)phenyl]methoxy]piperidin-4-imine |
| SMILES | FC(F)(F)c1cccc(CON=C2CCN(c3ncc(C(F)(F)F)cc3Cl)CC2)c1 |
| InChI | InChI=1S/C19H16ClF6N3O/c20-16-9-14(19(24,25)26)10-27-17(16)29-6-4-15(5-7-29)28-30-11-12-2-1-3-13(8-12)18(21,22)23/h1-3,8-10H,4-7,11H2 |
| InChIKey | ZKUDPBGOSNHYDU-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.80 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|