C22H33Cl2F3N4O3 — CID 87660268
3-[4-(2-hydroxyethyl)piperazin-1-yl]-1-[4-[[3-(trifluoromethyl)phenyl]methoxyimino]piperidin-1-yl]propan-1-one;dihydrochloride (PubChem CID 87660268) has the molecular formula C22H33Cl2F3N4O3 and a molecular weight of 529.43 g/mol. Its IUPAC name is 3-[4-(2-hydroxyethyl)piperazin-1-yl]-1-[4-[[3-(trifluoromethyl)phenyl]methoxyimino]piperidin-1-yl]propan-1-one;dihydrochloride.
| Compound Name | 3-[4-(2-hydroxyethyl)piperazin-1-yl]-1-[4-[[3-(trifluoromethyl)phenyl]methoxyimino]piperidin-1-yl]propan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 87660268 |
| Molecular Formula | C22H33Cl2F3N4O3 |
| Molecular Weight | 529.43 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | 3-[4-(2-hydroxyethyl)piperazin-1-yl]-1-[4-[[3-(trifluoromethyl)phenyl]methoxyimino]piperidin-1-yl]propan-1-one;dihydrochloride |
| SMILES | Cl.Cl.O=C(CCN1CCN(CCO)CC1)N1CCC(=NOCc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H31F3N4O3.2ClH/c23-22(24,25)19-3-1-2-18(16-19)17-32-26-20-4-8-29(9-5-20)21(31)6-7-27-10-12-28(13-11-27)14-15-30;;/h1-3,16,30H,4-15,17H2;2*1H |
| InChIKey | HURROLJZFUHIKX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 68.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|