C25H36F3N3O4 — CID 86636701
tert-butyl N-[(3S)-5-methyl-1-oxo-1-[4-[[3-(trifluoromethyl)phenyl]methoxyimino]piperidin-1-yl]hexan-3-yl]carbamate (PubChem CID 86636701) has the molecular formula C25H36F3N3O4 and a molecular weight of 499.57 g/mol. Its IUPAC name is tert-butyl N-[(3S)-5-methyl-1-oxo-1-[4-[[3-(trifluoromethyl)phenyl]methoxyimino]piperidin-1-yl]hexan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-5-methyl-1-oxo-1-[4-[[3-(trifluoromethyl)phenyl]methoxyimino]piperidin-1-yl]hexan-3-yl]carbamate |
|---|---|
| PubChem CID | 86636701 |
| Molecular Formula | C25H36F3N3O4 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | tert-butyl N-[(3S)-5-methyl-1-oxo-1-[4-[[3-(trifluoromethyl)phenyl]methoxyimino]piperidin-1-yl]hexan-3-yl]carbamate |
| SMILES | CC(C)C[C@@H](CC(=O)N1CCC(=NOCc2cccc(C(F)(F)F)c2)CC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H36F3N3O4/c1-17(2)13-21(29-23(33)35-24(3,4)5)15-22(32)31-11-9-20(10-12-31)30-34-16-18-7-6-8-19(14-18)25(26,27)28/h6-8,14,17,21H,9-13,15-16H2,1-5H3,(H,29,33)/t21-/m0/s1 |
| InChIKey | LGUKGQXQEKYADT-NRFANRHFSA-N |
| XLogP | 5.53 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|