C22H31ClF3N3O3 — CID 87661563
3-[(4-hydroxycyclohexyl)amino]-1-[4-[[3-(trifluoromethyl)phenyl]methoxyimino]piperidin-1-yl]propan-1-one;hydrochloride (PubChem CID 87661563) has the molecular formula C22H31ClF3N3O3 and a molecular weight of 477.96 g/mol. Its IUPAC name is 3-[(4-hydroxycyclohexyl)amino]-1-[4-[[3-(trifluoromethyl)phenyl]methoxyimino]piperidin-1-yl]propan-1-one;hydrochloride.
| Compound Name | 3-[(4-hydroxycyclohexyl)amino]-1-[4-[[3-(trifluoromethyl)phenyl]methoxyimino]piperidin-1-yl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 87661563 |
| Molecular Formula | C22H31ClF3N3O3 |
| Molecular Weight | 477.96 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 3-[(4-hydroxycyclohexyl)amino]-1-[4-[[3-(trifluoromethyl)phenyl]methoxyimino]piperidin-1-yl]propan-1-one;hydrochloride |
| SMILES | Cl.O=C(CCNC1CCC(O)CC1)N1CCC(=NOCc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H30F3N3O3.ClH/c23-22(24,25)17-3-1-2-16(14-17)15-31-27-19-9-12-28(13-10-19)21(30)8-11-26-18-4-6-20(29)7-5-18;/h1-3,14,18,20,26,29H,4-13,15H2;1H |
| InChIKey | ZHMXIRCQXHLTGX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.96 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|