C20H28F3N3O3 — CID 147053798
3-morpholin-4-yl-1-[4-[[3-(trifluoromethyl)phenyl]methoxyimino]piperidin-1-yl]propan-1-ol (PubChem CID 147053798) has the molecular formula C20H28F3N3O3 and a molecular weight of 415.46 g/mol. Its IUPAC name is 3-morpholin-4-yl-1-[4-[[3-(trifluoromethyl)phenyl]methoxyimino]piperidin-1-yl]propan-1-ol.
| Compound Name | 3-morpholin-4-yl-1-[4-[[3-(trifluoromethyl)phenyl]methoxyimino]piperidin-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 147053798 |
| Molecular Formula | C20H28F3N3O3 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 3-morpholin-4-yl-1-[4-[[3-(trifluoromethyl)phenyl]methoxyimino]piperidin-1-yl]propan-1-ol |
| SMILES | OC(CCN1CCOCC1)N1CCC(=NOCc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H28F3N3O3/c21-20(22,23)17-3-1-2-16(14-17)15-29-24-18-4-8-26(9-5-18)19(27)6-7-25-10-12-28-13-11-25/h1-3,14,19,27H,4-13,15H2 |
| InChIKey | BBVMBGNRTXWXJG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|