C18H12ClF6N2S+ — CID 2780858
N-[3,5-bis(trifluoromethyl)phenyl]-4-(4-chlorophenyl)-3-methyl-1,3-thiazol-3-ium-2-amine (PubChem CID 2780858) has the molecular formula C18H12ClF6N2S+ and a molecular weight of 437.82 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-4-(4-chlorophenyl)-3-methyl-1,3-thiazol-3-ium-2-amine.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-(4-chlorophenyl)-3-methyl-1,3-thiazol-3-ium-2-amine |
|---|---|
| PubChem CID | 2780858 |
| Molecular Formula | C18H12ClF6N2S+ |
| Molecular Weight | 437.82 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-(4-chlorophenyl)-3-methyl-1,3-thiazol-3-ium-2-amine |
| SMILES | C[n+]1c(-c2ccc(Cl)cc2)csc1Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H11ClF6N2S/c1-27-15(10-2-4-13(19)5-3-10)9-28-16(27)26-14-7-11(17(20,21)22)6-12(8-14)18(23,24)25/h2-9H,1H3/p+1 |
| InChIKey | ATPBCIJSLAMBMU-UHFFFAOYSA-O |
| XLogP | 6.67 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.82 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiaz_ene_D(8)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|