C26H24FN3O5 — CID 27810224
N-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 27810224) has the molecular formula C26H24FN3O5 and a molecular weight of 477.49 g/mol. Its IUPAC name is N-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 27810224 |
| Molecular Formula | C26H24FN3O5 |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | N-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | O=C(NC[C@@H](c1ccc(F)cc1)N1CCOCC1)c1ccc2c(c1)C(=O)N(Cc1ccco1)C2=O |
| InChI | InChI=1S/C26H24FN3O5/c27-19-6-3-17(4-7-19)23(29-9-12-34-13-10-29)15-28-24(31)18-5-8-21-22(14-18)26(33)30(25(21)32)16-20-2-1-11-35-20/h1-8,11,14,23H,9-10,12-13,15-16H2,(H,28,31)/t23-/m0/s1 |
| InChIKey | PPYSKOKRBSERID-QHCPKHFHSA-N |
| XLogP | 3.02 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|