C23H25N3O5S — CID 55658462
2-(furan-2-ylmethyl)-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 55658462) has the molecular formula C23H25N3O5S and a molecular weight of 455.54 g/mol. Its IUPAC name is 2-(furan-2-ylmethyl)-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(furan-2-ylmethyl)-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 55658462 |
| Molecular Formula | C23H25N3O5S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 2-(furan-2-ylmethyl)-N-[(3-morpholin-4-ylthiolan-3-yl)methyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | O=C(NCC1(N2CCOCC2)CCSC1)c1ccc2c(c1)C(=O)N(Cc1ccco1)C2=O |
| InChI | InChI=1S/C23H25N3O5S/c27-20(24-14-23(5-11-32-15-23)25-6-9-30-10-7-25)16-3-4-18-19(12-16)22(29)26(21(18)28)13-17-2-1-8-31-17/h1-4,8,12H,5-7,9-11,13-15H2,(H,24,27) |
| InChIKey | VMGHQBJLVLAWRZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|