C4H8O5 — CID 2781043
(2R,3R)-2,3,4-trihydroxybutanoic acid (PubChem CID 2781043) has the molecular formula C4H8O5 and a molecular weight of 136.10 g/mol. Its IUPAC name is (2R,3R)-2,3,4-trihydroxybutanoic acid.
| Compound Name | (2R,3R)-2,3,4-trihydroxybutanoic acid |
|---|---|
| PubChem CID | 2781043 |
| Molecular Formula | C4H8O5 |
| Molecular Weight | 136.10 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | (2R,3R)-2,3,4-trihydroxybutanoic acid |
| SMILES | O=C(O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C4H8O5/c5-1-2(6)3(7)4(8)9/h2-3,5-7H,1H2,(H,8,9)/t2-,3-/m1/s1 |
| InChIKey | JPIJQSOTBSSVTP-PWNYCUMCSA-N |
| XLogP | -2.21 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.10 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |