C9H12F7IO — CID 2782599
1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethoxy)octane (PubChem CID 2782599) has the molecular formula C9H12F7IO and a molecular weight of 396.08 g/mol. Its IUPAC name is 1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethoxy)octane.
| Compound Name | 1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethoxy)octane |
|---|---|
| PubChem CID | 2782599 |
| Molecular Formula | C9H12F7IO |
| Molecular Weight | 396.08 g/mol |
| Exact Mass | 395.98 |
| IUPAC Name | 1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethoxy)octane |
| SMILES | CCCCC(I)CC(F)(OC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H12F7IO/c1-2-3-4-6(17)5-7(10,8(11,12)13)18-9(14,15)16/h6H,2-5H2,1H3 |
| InChIKey | QQQSHSLFOZIZQR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.08 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|