C6H6F7IO2 — CID 7021687
(2S,4S)-4,5,5,5-tetrafluoro-2-iodo-4-(trifluoromethoxy)pentan-1-ol (PubChem CID 7021687) has the molecular formula C6H6F7IO2 and a molecular weight of 370.00 g/mol. Its IUPAC name is (2S,4S)-4,5,5,5-tetrafluoro-2-iodo-4-(trifluoromethoxy)pentan-1-ol.
| Compound Name | (2S,4S)-4,5,5,5-tetrafluoro-2-iodo-4-(trifluoromethoxy)pentan-1-ol |
|---|---|
| PubChem CID | 7021687 |
| Molecular Formula | C6H6F7IO2 |
| Molecular Weight | 370.00 g/mol |
| Exact Mass | 369.93 |
| IUPAC Name | (2S,4S)-4,5,5,5-tetrafluoro-2-iodo-4-(trifluoromethoxy)pentan-1-ol |
| SMILES | OC[C@@H](I)C[C@@](F)(OC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H6F7IO2/c7-4(5(8,9)10,1-3(14)2-15)16-6(11,12)13/h3,15H,1-2H2/t3-,4+/m0/s1 |
| InChIKey | KPABQJYHRYTITM-IUYQGCFVSA-N |
| XLogP | 2.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.00 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|