C12H10Cl2N2O2 — CID 2794917
1-(2,5-dichloro-4-nitrophenyl)-2,5-dimethylpyrrole (PubChem CID 2794917) has the molecular formula C12H10Cl2N2O2 and a molecular weight of 285.13 g/mol. Its IUPAC name is 1-(2,5-dichloro-4-nitrophenyl)-2,5-dimethylpyrrole.
| Compound Name | 1-(2,5-dichloro-4-nitrophenyl)-2,5-dimethylpyrrole |
|---|---|
| PubChem CID | 2794917 |
| Molecular Formula | C12H10Cl2N2O2 |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | 1-(2,5-dichloro-4-nitrophenyl)-2,5-dimethylpyrrole |
| SMILES | Cc1ccc(C)n1-c1cc(Cl)c([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C12H10Cl2N2O2/c1-7-3-4-8(2)15(7)11-5-10(14)12(16(17)18)6-9(11)13/h3-6H,1-2H3 |
| InChIKey | MLHGSKCNJTXMGV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|