C16H10Cl2N2O6 — CID 90745310
3-(2,5-dichloro-4-nitrophenyl)-4-hydroxy-5-(2-methoxyphenyl)-1,3-oxazol-2-one (PubChem CID 90745310) has the molecular formula C16H10Cl2N2O6 and a molecular weight of 397.17 g/mol. Its IUPAC name is 3-(2,5-dichloro-4-nitrophenyl)-4-hydroxy-5-(2-methoxyphenyl)-1,3-oxazol-2-one.
| Compound Name | 3-(2,5-dichloro-4-nitrophenyl)-4-hydroxy-5-(2-methoxyphenyl)-1,3-oxazol-2-one |
|---|---|
| PubChem CID | 90745310 |
| Molecular Formula | C16H10Cl2N2O6 |
| Molecular Weight | 397.17 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | 3-(2,5-dichloro-4-nitrophenyl)-4-hydroxy-5-(2-methoxyphenyl)-1,3-oxazol-2-one |
| SMILES | COc1ccccc1-c1oc(=O)n(-c2cc(Cl)c([N+](=O)[O-])cc2Cl)c1O |
| InChI | InChI=1S/C16H10Cl2N2O6/c1-25-13-5-3-2-4-8(13)14-15(21)19(16(22)26-14)11-6-10(18)12(20(23)24)7-9(11)17/h2-7,21H,1H3 |
| InChIKey | XGNMXNBGRQYRFG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 107.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.17 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|