C14H13F2NO3 — CID 2798532
3-methylpent-1-yn-3-yl N-(2,6-difluorobenzoyl)carbamate (PubChem CID 2798532) has the molecular formula C14H13F2NO3 and a molecular weight of 281.26 g/mol. Its IUPAC name is 3-methylpent-1-yn-3-yl N-(2,6-difluorobenzoyl)carbamate.
| Compound Name | 3-methylpent-1-yn-3-yl N-(2,6-difluorobenzoyl)carbamate |
|---|---|
| PubChem CID | 2798532 |
| Molecular Formula | C14H13F2NO3 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 3-methylpent-1-yn-3-yl N-(2,6-difluorobenzoyl)carbamate |
| SMILES | C#CC(C)(CC)OC(=O)NC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C14H13F2NO3/c1-4-14(3,5-2)20-13(19)17-12(18)11-9(15)7-6-8-10(11)16/h1,6-8H,5H2,2-3H3,(H,17,18,19) |
| InChIKey | FIZMVIFLFWKNKN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|