C10H16N6O — CID 2808474
N-(4-amino-6-piperidin-1-yl-1,3,5-triazin-2-yl)acetamide (PubChem CID 2808474) has the molecular formula C10H16N6O and a molecular weight of 236.28 g/mol. Its IUPAC name is N-(4-amino-6-piperidin-1-yl-1,3,5-triazin-2-yl)acetamide.
| Compound Name | N-(4-amino-6-piperidin-1-yl-1,3,5-triazin-2-yl)acetamide |
|---|---|
| PubChem CID | 2808474 |
| Molecular Formula | C10H16N6O |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | N-(4-amino-6-piperidin-1-yl-1,3,5-triazin-2-yl)acetamide |
| SMILES | CC(=O)Nc1nc(N)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C10H16N6O/c1-7(17)12-9-13-8(11)14-10(15-9)16-5-3-2-4-6-16/h2-6H2,1H3,(H3,11,12,13,14,15,17) |
| InChIKey | GCDKAEGNKYAOCS-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |