C26H25N5O3 — CID 2813828
2-(5-butyl-2,6-dioxo-11-phenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl)-N-phenylacetamide (PubChem CID 2813828) has the molecular formula C26H25N5O3 and a molecular weight of 455.52 g/mol. Its IUPAC name is 2-(5-butyl-2,6-dioxo-11-phenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl)-N-phenylacetamide.
| Compound Name | 2-(5-butyl-2,6-dioxo-11-phenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl)-N-phenylacetamide |
|---|---|
| PubChem CID | 2813828 |
| Molecular Formula | C26H25N5O3 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 2-(5-butyl-2,6-dioxo-11-phenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl)-N-phenylacetamide |
| SMILES | CCCCN1Cc2c(n(CC(=O)Nc3ccccc3)c3cc(-c4ccccc4)nn3c2=O)C1=O |
| InChI | InChI=1S/C26H25N5O3/c1-2-3-14-29-16-20-24(26(29)34)30(17-22(32)27-19-12-8-5-9-13-19)23-15-21(28-31(23)25(20)33)18-10-6-4-7-11-18/h4-13,15H,2-3,14,16-17H2,1H3,(H,27,32) |
| InChIKey | SYATYUSHAMZWRL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |