C23H27N5O3 — CID 136590448
2-(5-butyl-2,6-dioxo-11-phenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl)-N-propan-2-ylacetamide (PubChem CID 136590448) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is 2-(5-butyl-2,6-dioxo-11-phenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl)-N-propan-2-ylacetamide.
| Compound Name | 2-(5-butyl-2,6-dioxo-11-phenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 136590448 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 2-(5-butyl-2,6-dioxo-11-phenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl)-N-propan-2-ylacetamide |
| SMILES | CCCCN1Cc2c(n(CC(=O)NC(C)C)c3cc(-c4ccccc4)nn3c2=O)C1=O |
| InChI | InChI=1S/C23H27N5O3/c1-4-5-11-26-13-17-21(23(26)31)27(14-19(29)24-15(2)3)20-12-18(25-28(20)22(17)30)16-9-7-6-8-10-16/h6-10,12,15H,4-5,11,13-14H2,1-3H3,(H,24,29) |
| InChIKey | JSSFSGCDTSJSOZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |