C25H29N5O4 — CID 46138134
2-[2,6-dioxo-5-(oxolan-2-ylmethyl)-11-phenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]-N-(2-methylpropyl)acetamide (PubChem CID 46138134) has the molecular formula C25H29N5O4 and a molecular weight of 463.54 g/mol. Its IUPAC name is 2-[2,6-dioxo-5-(oxolan-2-ylmethyl)-11-phenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]-N-(2-methylpropyl)acetamide.
| Compound Name | 2-[2,6-dioxo-5-(oxolan-2-ylmethyl)-11-phenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 46138134 |
| Molecular Formula | C25H29N5O4 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 2-[2,6-dioxo-5-(oxolan-2-ylmethyl)-11-phenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]-N-(2-methylpropyl)acetamide |
| SMILES | CC(C)CNC(=O)Cn1c2c(c(=O)n3nc(-c4ccccc4)cc13)CN(CC1CCCO1)C2=O |
| InChI | InChI=1S/C25H29N5O4/c1-16(2)12-26-21(31)15-29-22-11-20(17-7-4-3-5-8-17)27-30(22)24(32)19-14-28(25(33)23(19)29)13-18-9-6-10-34-18/h3-5,7-8,11,16,18H,6,9-10,12-15H2,1-2H3,(H,26,31) |
| InChIKey | UKFUEPBSSXZFHH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 97.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |