C24H28N6O4 — CID 42816503
N-ethyl-2-[5-(2-morpholin-4-ylethyl)-2,6-dioxo-11-phenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]acetamide (PubChem CID 42816503) has the molecular formula C24H28N6O4 and a molecular weight of 464.53 g/mol. Its IUPAC name is N-ethyl-2-[5-(2-morpholin-4-ylethyl)-2,6-dioxo-11-phenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]acetamide.
| Compound Name | N-ethyl-2-[5-(2-morpholin-4-ylethyl)-2,6-dioxo-11-phenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]acetamide |
|---|---|
| PubChem CID | 42816503 |
| Molecular Formula | C24H28N6O4 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | N-ethyl-2-[5-(2-morpholin-4-ylethyl)-2,6-dioxo-11-phenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]acetamide |
| SMILES | CCNC(=O)Cn1c2c(c(=O)n3nc(-c4ccccc4)cc13)CN(CCN1CCOCC1)C2=O |
| InChI | InChI=1S/C24H28N6O4/c1-2-25-20(31)16-29-21-14-19(17-6-4-3-5-7-17)26-30(21)23(32)18-15-28(24(33)22(18)29)9-8-27-10-12-34-13-11-27/h3-7,14H,2,8-13,15-16H2,1H3,(H,25,31) |
| InChIKey | ITWSQBCACPBMAT-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 101.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |