C21H31N5O4 — CID 42816462
2-[11-tert-butyl-5-(2-methylpropyl)-2,6-dioxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 42816462) has the molecular formula C21H31N5O4 and a molecular weight of 417.51 g/mol. Its IUPAC name is 2-[11-tert-butyl-5-(2-methylpropyl)-2,6-dioxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[11-tert-butyl-5-(2-methylpropyl)-2,6-dioxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 42816462 |
| Molecular Formula | C21H31N5O4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 2-[11-tert-butyl-5-(2-methylpropyl)-2,6-dioxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)Cn1c2c(c(=O)n3nc(C(C)(C)C)cc13)CN(CC(C)C)C2=O |
| InChI | InChI=1S/C21H31N5O4/c1-13(2)10-24-11-14-18(20(24)29)25(12-16(27)22-7-8-30-6)17-9-15(21(3,4)5)23-26(17)19(14)28/h9,13H,7-8,10-12H2,1-6H3,(H,22,27) |
| InChIKey | DZUXSVWBFGQTQP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 97.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|