C14H15ClO4S — CID 2826077
dimethyl 2-(4-chloro-2,5-dimethylphenyl)sulfanylbut-2-enedioate (PubChem CID 2826077) has the molecular formula C14H15ClO4S and a molecular weight of 314.79 g/mol. Its IUPAC name is dimethyl 2-(4-chloro-2,5-dimethylphenyl)sulfanylbut-2-enedioate.
| Compound Name | dimethyl 2-(4-chloro-2,5-dimethylphenyl)sulfanylbut-2-enedioate |
|---|---|
| PubChem CID | 2826077 |
| Molecular Formula | C14H15ClO4S |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | dimethyl 2-(4-chloro-2,5-dimethylphenyl)sulfanylbut-2-enedioate |
| SMILES | COC(=O)C=C(Sc1cc(C)c(Cl)cc1C)C(=O)OC |
| InChI | InChI=1S/C14H15ClO4S/c1-8-6-11(9(2)5-10(8)15)20-12(14(17)19-4)7-13(16)18-3/h5-7H,1-4H3 |
| InChIKey | LRCRBAJWPXUHBE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|