About 2-(3-amino-1H-1,2,4-triazol-4-ium-5-yl)ethylazanium dichloride
2-(3-amino-1H-1,2,4-triazol-4-ium-5-yl)ethylazanium dichloride (PubChem CID 2829133) has the molecular formula C4H11Cl2N5
and a molecular weight of 200.07 g/mol. Its IUPAC name is 2-(3-amino-1H-1,2,4-triazol-4-ium-5-yl)ethylazanium dichloride.
Analyze 2-(3-amino-1H-1,2,4-triazol-4-ium-5-yl)ethylazanium dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-amino-1H-1,2,4-triazol-4-ium-5-yl)ethylazanium dichloride?
The IUPAC name of 2-(3-amino-1H-1,2,4-triazol-4-ium-5-yl)ethylazanium dichloride (CID 2829133) is 2-(3-amino-1H-1,2,4-triazol-4-ium-5-yl)ethylazanium dichloride.
What is the SMILES notation for 2-(3-amino-1H-1,2,4-triazol-4-ium-5-yl)ethylazanium dichloride?
The canonical SMILES for 2-(3-amino-1H-1,2,4-triazol-4-ium-5-yl)ethylazanium dichloride is Nc1n[nH]c(CC[NH3+])[nH+]1.[Cl-].[Cl-].
What is the InChIKey of 2-(3-amino-1H-1,2,4-triazol-4-ium-5-yl)ethylazanium dichloride?
The InChIKey is WNKJGECUPKBBPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N5.2ClH/c5-2-1-3-7-4(6)9-8-3;;/h1-2,5H2,(H3,6,7,8,9);2*1H.
What are the key properties of 2-(3-amino-1H-1,2,4-triazol-4-ium-5-yl)ethylazanium dichloride?
2-(3-amino-1H-1,2,4-triazol-4-ium-5-yl)ethylazanium dichloride has a molecular weight of 200.07 g/mol, XLogP of -8.40, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-amino-1H-1,2,4-triazol-4-ium-5-yl)ethylazanium dichloride is sourced from PubChem (CID 2829133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).