About 5-(aminomethyl)-1H-1,2,4-triazol-3-amine;dihydrochloride
5-(aminomethyl)-1H-1,2,4-triazol-3-amine;dihydrochloride (PubChem CID 53444473) has the molecular formula C3H9Cl2N5
and a molecular weight of 186.05 g/mol. Its IUPAC name is 5-(aminomethyl)-1H-1,2,4-triazol-3-amine;dihydrochloride.
Molecular Properties
| Compound Name | 5-(aminomethyl)-1H-1,2,4-triazol-3-amine;dihydrochloride |
| PubChem CID | 53444473 |
| Molecular Formula | C3H9Cl2N5 |
| Molecular Weight | 186.05 g/mol |
| Exact Mass | 185.02 |
| IUPAC Name | 5-(aminomethyl)-1H-1,2,4-triazol-3-amine;dihydrochloride |
| SMILES | Cl.Cl.NCc1nc(N)n[nH]1 |
| InChI | InChI=1S/C3H7N5.2ClH/c4-1-2-6-3(5)8-7-2;;/h1,4H2,(H3,5,6,7,8);2*1H |
| InChIKey | JJDDKKBACSMESB-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.05 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(aminomethyl)-1H-1,2,4-triazol-3-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)-1H-1,2,4-triazol-3-amine;dihydrochloride?
The IUPAC name of 5-(aminomethyl)-1H-1,2,4-triazol-3-amine;dihydrochloride (CID 53444473) is 5-(aminomethyl)-1H-1,2,4-triazol-3-amine;dihydrochloride.
What is the SMILES notation for 5-(aminomethyl)-1H-1,2,4-triazol-3-amine;dihydrochloride?
The canonical SMILES for 5-(aminomethyl)-1H-1,2,4-triazol-3-amine;dihydrochloride is Cl.Cl.NCc1nc(N)n[nH]1.
What is the InChIKey of 5-(aminomethyl)-1H-1,2,4-triazol-3-amine;dihydrochloride?
The InChIKey is JJDDKKBACSMESB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7N5.2ClH/c4-1-2-6-3(5)8-7-2;;/h1,4H2,(H3,5,6,7,8);2*1H.
What are the key properties of 5-(aminomethyl)-1H-1,2,4-triazol-3-amine;dihydrochloride?
5-(aminomethyl)-1H-1,2,4-triazol-3-amine;dihydrochloride has a molecular weight of 186.05 g/mol, XLogP of -0.31, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)-1H-1,2,4-triazol-3-amine;dihydrochloride is sourced from PubChem (CID 53444473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).