C18H17NO4S — CID 2829333
N-tert-butyl-9,10-dioxoanthracene-2-sulfonamide (PubChem CID 2829333) has the molecular formula C18H17NO4S and a molecular weight of 343.40 g/mol. Its IUPAC name is N-tert-butyl-9,10-dioxoanthracene-2-sulfonamide.
| Compound Name | N-tert-butyl-9,10-dioxoanthracene-2-sulfonamide |
|---|---|
| PubChem CID | 2829333 |
| Molecular Formula | C18H17NO4S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | N-tert-butyl-9,10-dioxoanthracene-2-sulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H17NO4S/c1-18(2,3)19-24(22,23)11-8-9-14-15(10-11)17(21)13-7-5-4-6-12(13)16(14)20/h4-10,19H,1-3H3 |
| InChIKey | LWNJBYGFPRLQHH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|