About N-tert-butyl-9,10-dioxoanthracene-2-sulfonamide
N-tert-butyl-9,10-dioxoanthracene-2-sulfonamide (PubChem CID 2829333) has the molecular formula C18H17NO4S
and a molecular weight of 343.40 g/mol. Its IUPAC name is N-tert-butyl-9,10-dioxoanthracene-2-sulfonamide.
Molecular Properties
| Compound Name | N-tert-butyl-9,10-dioxoanthracene-2-sulfonamide |
| PubChem CID | 2829333 |
| Molecular Formula | C18H17NO4S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | N-tert-butyl-9,10-dioxoanthracene-2-sulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H17NO4S/c1-18(2,3)19-24(22,23)11-8-9-14-15(10-11)17(21)13-7-5-4-6-12(13)16(14)20/h4-10,19H,1-3H3 |
| InChIKey | LWNJBYGFPRLQHH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-9,10-dioxoanthracene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-9,10-dioxoanthracene-2-sulfonamide?
The IUPAC name of N-tert-butyl-9,10-dioxoanthracene-2-sulfonamide (CID 2829333) is N-tert-butyl-9,10-dioxoanthracene-2-sulfonamide.
What is the SMILES notation for N-tert-butyl-9,10-dioxoanthracene-2-sulfonamide?
The canonical SMILES for N-tert-butyl-9,10-dioxoanthracene-2-sulfonamide is CC(C)(C)NS(=O)(=O)c1ccc2c(c1)C(=O)c1ccccc1C2=O.
What is the InChIKey of N-tert-butyl-9,10-dioxoanthracene-2-sulfonamide?
The InChIKey is LWNJBYGFPRLQHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO4S/c1-18(2,3)19-24(22,23)11-8-9-14-15(10-11)17(21)13-7-5-4-6-12(13)16(14)20/h4-10,19H,1-3H3.
What are the key properties of N-tert-butyl-9,10-dioxoanthracene-2-sulfonamide?
N-tert-butyl-9,10-dioxoanthracene-2-sulfonamide has a molecular weight of 343.40 g/mol, XLogP of 2.54, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-9,10-dioxoanthracene-2-sulfonamide is sourced from PubChem (CID 2829333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).