C41H34N2O4 — CID 2832543
N-[4-[[4-[(2,2-diphenylacetyl)amino]-3-hydroxyphenyl]methyl]-2-hydroxyphenyl]-2,2-diphenylacetamide (PubChem CID 2832543) has the molecular formula C41H34N2O4 and a molecular weight of 618.73 g/mol. Its IUPAC name is N-[4-[[4-[(2,2-diphenylacetyl)amino]-3-hydroxyphenyl]methyl]-2-hydroxyphenyl]-2,2-diphenylacetamide.
| Compound Name | N-[4-[[4-[(2,2-diphenylacetyl)amino]-3-hydroxyphenyl]methyl]-2-hydroxyphenyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 2832543 |
| Molecular Formula | C41H34N2O4 |
| Molecular Weight | 618.73 g/mol |
| Exact Mass | 618.25 |
| IUPAC Name | N-[4-[[4-[(2,2-diphenylacetyl)amino]-3-hydroxyphenyl]methyl]-2-hydroxyphenyl]-2,2-diphenylacetamide |
| SMILES | O=C(Nc1ccc(Cc2ccc(NC(=O)C(c3ccccc3)c3ccccc3)c(O)c2)cc1O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H34N2O4/c44-36-26-28(21-23-34(36)42-40(46)38(30-13-5-1-6-14-30)31-15-7-2-8-16-31)25-29-22-24-35(37(45)27-29)43-41(47)39(32-17-9-3-10-18-32)33-19-11-4-12-20-33/h1-24,26-27,38-39,44-45H,25H2,(H,42,46)(H,43,47) |
| InChIKey | UADYPWPONRIPFE-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.73 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|