C17H20N4O4S — CID 2866567
(1-methyl-2,5-dioxopyrrolidin-3-yl) N'-[4-(1,3-benzodioxol-5-yl)butan-2-ylideneamino]carbamimidothioate (PubChem CID 2866567) has the molecular formula C17H20N4O4S and a molecular weight of 376.44 g/mol. Its IUPAC name is (1-methyl-2,5-dioxopyrrolidin-3-yl) N'-[4-(1,3-benzodioxol-5-yl)butan-2-ylideneamino]carbamimidothioate.
| Compound Name | (1-methyl-2,5-dioxopyrrolidin-3-yl) N'-[4-(1,3-benzodioxol-5-yl)butan-2-ylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 2866567 |
| Molecular Formula | C17H20N4O4S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | (1-methyl-2,5-dioxopyrrolidin-3-yl) N'-[4-(1,3-benzodioxol-5-yl)butan-2-ylideneamino]carbamimidothioate |
| SMILES | CC(CCc1ccc2c(c1)OCO2)=NN=C(N)SC1CC(=O)N(C)C1=O |
| InChI | InChI=1S/C17H20N4O4S/c1-10(3-4-11-5-6-12-13(7-11)25-9-24-12)19-20-17(18)26-14-8-15(22)21(2)16(14)23/h5-7,14H,3-4,8-9H2,1-2H3,(H2,18,20) |
| InChIKey | IFNPXBPOYDATLJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 106.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|