C15H27NO3 — CID 28719562
N-[3-(cyclopropylmethoxy)propyl]-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 28719562) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is N-[3-(cyclopropylmethoxy)propyl]-1,4-dioxaspiro[4.5]decan-8-amine.
| Compound Name | N-[3-(cyclopropylmethoxy)propyl]-1,4-dioxaspiro[4.5]decan-8-amine |
|---|---|
| PubChem CID | 28719562 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | N-[3-(cyclopropylmethoxy)propyl]-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | C(CNC1CCC2(CC1)OCCO2)COCC1CC1 |
| InChI | InChI=1S/C15H27NO3/c1(9-17-12-13-2-3-13)8-16-14-4-6-15(7-5-14)18-10-11-19-15/h13-14,16H,1-12H2 |
| InChIKey | FBROBYCCAGMLIV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|