C10H17F2NO2 — CID 115405683
N-(2,2-difluoroethyl)-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 115405683) has the molecular formula C10H17F2NO2 and a molecular weight of 221.25 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-1,4-dioxaspiro[4.5]decan-8-amine.
| Compound Name | N-(2,2-difluoroethyl)-1,4-dioxaspiro[4.5]decan-8-amine |
|---|---|
| PubChem CID | 115405683 |
| Molecular Formula | C10H17F2NO2 |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N-(2,2-difluoroethyl)-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | FC(F)CNC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C10H17F2NO2/c11-9(12)7-13-8-1-3-10(4-2-8)14-5-6-15-10/h8-9,13H,1-7H2 |
| InChIKey | ZDFNSBMSMXITFG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |