C13H22F3NO2 — CID 115516969
N-(5,5,5-trifluoropentyl)-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 115516969) has the molecular formula C13H22F3NO2 and a molecular weight of 281.32 g/mol. Its IUPAC name is N-(5,5,5-trifluoropentyl)-1,4-dioxaspiro[4.5]decan-8-amine.
| Compound Name | N-(5,5,5-trifluoropentyl)-1,4-dioxaspiro[4.5]decan-8-amine |
|---|---|
| PubChem CID | 115516969 |
| Molecular Formula | C13H22F3NO2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | N-(5,5,5-trifluoropentyl)-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | FC(F)(F)CCCCNC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C13H22F3NO2/c14-13(15,16)5-1-2-8-17-11-3-6-12(7-4-11)18-9-10-19-12/h11,17H,1-10H2 |
| InChIKey | XXSVHLPEIYCNFA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|