C12H13ClN2 — CID 28744121
(1S)-8-chloro-2,3,4,9-tetrahydro-1H-carbazol-1-amine (PubChem CID 28744121) has the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. Its IUPAC name is (1S)-8-chloro-2,3,4,9-tetrahydro-1H-carbazol-1-amine.
| Compound Name | (1S)-8-chloro-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
|---|---|
| PubChem CID | 28744121 |
| Molecular Formula | C12H13ClN2 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | (1S)-8-chloro-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| SMILES | N[C@H]1CCCc2c1[nH]c1c(Cl)cccc21 |
| InChI | InChI=1S/C12H13ClN2/c13-9-5-1-3-7-8-4-2-6-10(14)12(8)15-11(7)9/h1,3,5,10,15H,2,4,6,14H2/t10-/m0/s1 |
| InChIKey | QKYSNOKOSXWELO-JTQLQIEISA-N |
| XLogP | 3.16 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|