C11H10N2O6S — CID 28774384
3-[(1,3-dioxoisoindol-5-yl)sulfamoyl]propanoic acid (PubChem CID 28774384) has the molecular formula C11H10N2O6S and a molecular weight of 298.28 g/mol. Its IUPAC name is 3-[(1,3-dioxoisoindol-5-yl)sulfamoyl]propanoic acid.
| Compound Name | 3-[(1,3-dioxoisoindol-5-yl)sulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 28774384 |
| Molecular Formula | C11H10N2O6S |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 3-[(1,3-dioxoisoindol-5-yl)sulfamoyl]propanoic acid |
| SMILES | O=C(O)CCS(=O)(=O)Nc1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C11H10N2O6S/c14-9(15)3-4-20(18,19)13-6-1-2-7-8(5-6)11(17)12-10(7)16/h1-2,5,13H,3-4H2,(H,14,15)(H,12,16,17) |
| InChIKey | XYGKCQNFTOGEKO-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|