C26H25N9 — CID 2886623
4-[2,2-bis(1-phenyltetrazol-5-yl)ethenyl]-N,N-diethylaniline (PubChem CID 2886623) has the molecular formula C26H25N9 and a molecular weight of 463.55 g/mol. Its IUPAC name is 4-[2,2-bis(1-phenyltetrazol-5-yl)ethenyl]-N,N-diethylaniline.
| Compound Name | 4-[2,2-bis(1-phenyltetrazol-5-yl)ethenyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 2886623 |
| Molecular Formula | C26H25N9 |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 4-[2,2-bis(1-phenyltetrazol-5-yl)ethenyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(C=C(c2nnnn2-c2ccccc2)c2nnnn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H25N9/c1-3-33(4-2)21-17-15-20(16-18-21)19-24(25-27-29-31-34(25)22-11-7-5-8-12-22)26-28-30-32-35(26)23-13-9-6-10-14-23/h5-19H,3-4H2,1-2H3 |
| InChIKey | PDGPVPNCIQNQKH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 90.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|