C23H19N3O3S — CID 28888268
2-[(4-nitrophenyl)methyl]-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 28888268) has the molecular formula C23H19N3O3S and a molecular weight of 417.49 g/mol. Its IUPAC name is 2-[(4-nitrophenyl)methyl]-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(4-nitrophenyl)methyl]-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 28888268 |
| Molecular Formula | C23H19N3O3S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 2-[(4-nitrophenyl)methyl]-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(Cc2ccc([N+](=O)[O-])cc2)nc2scc(-c3ccc4c(c3)CCCC4)c12 |
| InChI | InChI=1S/C23H19N3O3S/c27-22-21-19(17-8-7-15-3-1-2-4-16(15)12-17)13-30-23(21)25-20(24-22)11-14-5-9-18(10-6-14)26(28)29/h5-10,12-13H,1-4,11H2,(H,24,25,27) |
| InChIKey | OPHQLAQLANCMBC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|