C16H13BrClNO4 — CID 28913362
2-(4-bromo-2-formyl-6-methoxyphenoxy)-N-(2-chlorophenyl)acetamide (PubChem CID 28913362) has the molecular formula C16H13BrClNO4 and a molecular weight of 398.64 g/mol. Its IUPAC name is 2-(4-bromo-2-formyl-6-methoxyphenoxy)-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-(4-bromo-2-formyl-6-methoxyphenoxy)-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 28913362 |
| Molecular Formula | C16H13BrClNO4 |
| Molecular Weight | 398.64 g/mol |
| Exact Mass | 396.97 |
| IUPAC Name | 2-(4-bromo-2-formyl-6-methoxyphenoxy)-N-(2-chlorophenyl)acetamide |
| SMILES | COc1cc(Br)cc(C=O)c1OCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C16H13BrClNO4/c1-22-14-7-11(17)6-10(8-20)16(14)23-9-15(21)19-13-5-3-2-4-12(13)18/h2-8H,9H2,1H3,(H,19,21) |
| InChIKey | JDDKXXPHZMXXLC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.64 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|