C21H21Cl2N3S2 — CID 29055901
3-[(3,4-dichlorophenyl)methylsulfanyl]-5-[(6R)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 29055901) has the molecular formula C21H21Cl2N3S2 and a molecular weight of 450.46 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methylsulfanyl]-5-[(6R)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-[(3,4-dichlorophenyl)methylsulfanyl]-5-[(6R)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 29055901 |
| Molecular Formula | C21H21Cl2N3S2 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methylsulfanyl]-5-[(6R)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(SCc2ccc(Cl)c(Cl)c2)nnc1-c1csc2c1CC[C@@H](C)C2 |
| InChI | InChI=1S/C21H21Cl2N3S2/c1-3-8-26-20(16-12-27-19-9-13(2)4-6-15(16)19)24-25-21(26)28-11-14-5-7-17(22)18(23)10-14/h3,5,7,10,12-13H,1,4,6,8-9,11H2,2H3/t13-/m1/s1 |
| InChIKey | YDWUBOHPYJSUCL-CYBMUJFWSA-N |
| XLogP | 6.92 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|