C17H19FN4O4S — CID 29132624
(2R)-5-(carbamoylamino)-2-[[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetyl]amino]pentanoic acid (PubChem CID 29132624) has the molecular formula C17H19FN4O4S and a molecular weight of 394.43 g/mol. Its IUPAC name is (2R)-5-(carbamoylamino)-2-[[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetyl]amino]pentanoic acid.
| Compound Name | (2R)-5-(carbamoylamino)-2-[[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 29132624 |
| Molecular Formula | C17H19FN4O4S |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | (2R)-5-(carbamoylamino)-2-[[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetyl]amino]pentanoic acid |
| SMILES | NC(=O)NCCC[C@@H](NC(=O)Cc1csc(-c2ccc(F)cc2)n1)C(=O)O |
| InChI | InChI=1S/C17H19FN4O4S/c18-11-5-3-10(4-6-11)15-21-12(9-27-15)8-14(23)22-13(16(24)25)2-1-7-20-17(19)26/h3-6,9,13H,1-2,7-8H2,(H,22,23)(H,24,25)(H3,19,20,26)/t13-/m1/s1 |
| InChIKey | HBOLYXCQGJLXEL-CYBMUJFWSA-N |
| XLogP | 1.51 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|