C19H19N7O3 — CID 2921052
7-N,7-N,11-N,11-N-tetramethyl-9-(4-nitrophenyl)-2-oxa-4,6,12,14-tetrazatricyclo[8.4.0.03,8]tetradeca-1(14),3,5,7,10,12-hexaene-7,11-diamine (PubChem CID 2921052) has the molecular formula C19H19N7O3 and a molecular weight of 393.41 g/mol. Its IUPAC name is 7-N,7-N,11-N,11-N-tetramethyl-9-(4-nitrophenyl)-2-oxa-4,6,12,14-tetrazatricyclo[8.4.0.03,8]tetradeca-1(14),3,5,7,10,12-hexaene-7,11-diamine.
| Compound Name | 7-N,7-N,11-N,11-N-tetramethyl-9-(4-nitrophenyl)-2-oxa-4,6,12,14-tetrazatricyclo[8.4.0.03,8]tetradeca-1(14),3,5,7,10,12-hexaene-7,11-diamine |
|---|---|
| PubChem CID | 2921052 |
| Molecular Formula | C19H19N7O3 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 7-N,7-N,11-N,11-N-tetramethyl-9-(4-nitrophenyl)-2-oxa-4,6,12,14-tetrazatricyclo[8.4.0.03,8]tetradeca-1(14),3,5,7,10,12-hexaene-7,11-diamine |
| SMILES | CN(C)c1ncnc2c1C(c1ccc([N+](=O)[O-])cc1)c1c(ncnc1N(C)C)O2 |
| InChI | InChI=1S/C19H19N7O3/c1-24(2)16-14-13(11-5-7-12(8-6-11)26(27)28)15-17(25(3)4)21-10-23-19(15)29-18(14)22-9-20-16/h5-10,13H,1-4H3 |
| InChIKey | OVSWFOUMJPIOAX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 110.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|