C19H11FN4O3S — CID 155927400
15-fluoro-2-(4-nitrophenyl)-9-oxa-17-thia-5,7-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3,5,7,11(16),12,14-heptaen-4-amine (PubChem CID 155927400) has the molecular formula C19H11FN4O3S and a molecular weight of 394.39 g/mol. Its IUPAC name is 15-fluoro-2-(4-nitrophenyl)-9-oxa-17-thia-5,7-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3,5,7,11(16),12,14-heptaen-4-amine.
| Compound Name | 15-fluoro-2-(4-nitrophenyl)-9-oxa-17-thia-5,7-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3,5,7,11(16),12,14-heptaen-4-amine |
|---|---|
| PubChem CID | 155927400 |
| Molecular Formula | C19H11FN4O3S |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 15-fluoro-2-(4-nitrophenyl)-9-oxa-17-thia-5,7-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3,5,7,11(16),12,14-heptaen-4-amine |
| SMILES | Nc1ncnc2c1C(c1ccc([N+](=O)[O-])cc1)c1sc3c(F)cccc3c1O2 |
| InChI | InChI=1S/C19H11FN4O3S/c20-12-3-1-2-11-15-17(28-16(11)12)13(9-4-6-10(7-5-9)24(25)26)14-18(21)22-8-23-19(14)27-15/h1-8,13H,(H2,21,22,23) |
| InChIKey | CVUGVNGGZIBESX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 104.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|