C20H24FN5O2S — CID 29339470
4-fluoro-N-[6-[4-(4-methylpiperazin-1-yl)-4-oxobutyl]sulfanylpyridazin-3-yl]benzamide (PubChem CID 29339470) has the molecular formula C20H24FN5O2S and a molecular weight of 417.51 g/mol. Its IUPAC name is 4-fluoro-N-[6-[4-(4-methylpiperazin-1-yl)-4-oxobutyl]sulfanylpyridazin-3-yl]benzamide.
| Compound Name | 4-fluoro-N-[6-[4-(4-methylpiperazin-1-yl)-4-oxobutyl]sulfanylpyridazin-3-yl]benzamide |
|---|---|
| PubChem CID | 29339470 |
| Molecular Formula | C20H24FN5O2S |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 4-fluoro-N-[6-[4-(4-methylpiperazin-1-yl)-4-oxobutyl]sulfanylpyridazin-3-yl]benzamide |
| SMILES | CN1CCN(C(=O)CCCSc2ccc(NC(=O)c3ccc(F)cc3)nn2)CC1 |
| InChI | InChI=1S/C20H24FN5O2S/c1-25-10-12-26(13-11-25)19(27)3-2-14-29-18-9-8-17(23-24-18)22-20(28)15-4-6-16(21)7-5-15/h4-9H,2-3,10-14H2,1H3,(H,22,23,28) |
| InChIKey | MDWHKZFUJLPLGQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|