C10H18N2O4S — CID 29378721
ethyl 2-[(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl]sulfanylacetate (PubChem CID 29378721) has the molecular formula C10H18N2O4S and a molecular weight of 262.33 g/mol. Its IUPAC name is ethyl 2-[(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl]sulfanylacetate.
| Compound Name | ethyl 2-[(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 29378721 |
| Molecular Formula | C10H18N2O4S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | ethyl 2-[(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl]sulfanylacetate |
| SMILES | CCOC(=O)CS[C@@H](C(=O)NC(N)=O)C(C)C |
| InChI | InChI=1S/C10H18N2O4S/c1-4-16-7(13)5-17-8(6(2)3)9(14)12-10(11)15/h6,8H,4-5H2,1-3H3,(H3,11,12,14,15)/t8-/m1/s1 |
| InChIKey | CJYMALRZHVHHOQ-MRVPVSSYSA-N |
| XLogP | 0.50 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |