C27H30N4O6S — CID 2954272
2-[5-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-2-nitrophenyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 2954272) has the molecular formula C27H30N4O6S and a molecular weight of 538.63 g/mol. Its IUPAC name is 2-[5-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-2-nitrophenyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-[5-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-2-nitrophenyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 2954272 |
| Molecular Formula | C27H30N4O6S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | 2-[5-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-2-nitrophenyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(c3ccc([N+](=O)[O-])c(N4CCc5ccccc5C4)c3)CC2)cc1OC |
| InChI | InChI=1S/C27H30N4O6S/c1-36-26-10-8-23(18-27(26)37-2)38(34,35)30-15-13-28(14-16-30)22-7-9-24(31(32)33)25(17-22)29-12-11-20-5-3-4-6-21(20)19-29/h3-10,17-18H,11-16,19H2,1-2H3 |
| InChIKey | YNTMZFVAKVUBKY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 105.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|