C32H32N4O7S — CID 17385236
5-(4-dibenzofuran-2-ylsulfonylpiperazin-1-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-nitroaniline (PubChem CID 17385236) has the molecular formula C32H32N4O7S and a molecular weight of 616.70 g/mol. Its IUPAC name is 5-(4-dibenzofuran-2-ylsulfonylpiperazin-1-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-nitroaniline.
| Compound Name | 5-(4-dibenzofuran-2-ylsulfonylpiperazin-1-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-nitroaniline |
|---|---|
| PubChem CID | 17385236 |
| Molecular Formula | C32H32N4O7S |
| Molecular Weight | 616.70 g/mol |
| Exact Mass | 616.20 |
| IUPAC Name | 5-(4-dibenzofuran-2-ylsulfonylpiperazin-1-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-nitroaniline |
| SMILES | COc1ccc(CCNc2cc(N3CCN(S(=O)(=O)c4ccc5oc6ccccc6c5c4)CC3)ccc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C32H32N4O7S/c1-41-31-11-7-22(19-32(31)42-2)13-14-33-27-20-23(8-10-28(27)36(37)38)34-15-17-35(18-16-34)44(39,40)24-9-12-30-26(21-24)25-5-3-4-6-29(25)43-30/h3-12,19-21,33H,13-18H2,1-2H3 |
| InChIKey | BOJMVVKAOJDTID-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 127.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.70 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|