C25H27FN4O5S — CID 141260171
N-[[5-[4-(3-fluoro-4-methoxyphenyl)sulfonylpiperazin-1-yl]-2-nitrophenyl]methyl]-1-phenylmethanamine (PubChem CID 141260171) has the molecular formula C25H27FN4O5S and a molecular weight of 514.58 g/mol. Its IUPAC name is N-[[5-[4-(3-fluoro-4-methoxyphenyl)sulfonylpiperazin-1-yl]-2-nitrophenyl]methyl]-1-phenylmethanamine.
| Compound Name | N-[[5-[4-(3-fluoro-4-methoxyphenyl)sulfonylpiperazin-1-yl]-2-nitrophenyl]methyl]-1-phenylmethanamine |
|---|---|
| PubChem CID | 141260171 |
| Molecular Formula | C25H27FN4O5S |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | N-[[5-[4-(3-fluoro-4-methoxyphenyl)sulfonylpiperazin-1-yl]-2-nitrophenyl]methyl]-1-phenylmethanamine |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(c3ccc([N+](=O)[O-])c(CNCc4ccccc4)c3)CC2)cc1F |
| InChI | InChI=1S/C25H27FN4O5S/c1-35-25-10-8-22(16-23(25)26)36(33,34)29-13-11-28(12-14-29)21-7-9-24(30(31)32)20(15-21)18-27-17-19-5-3-2-4-6-19/h2-10,15-16,27H,11-14,17-18H2,1H3 |
| InChIKey | JNMDIZMJEUZHKM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|