C17H19Cl2N3O3S — CID 2954418
1-[(4-butylphenyl)sulfonylamino]-3-(2,3-dichlorophenyl)urea (PubChem CID 2954418) has the molecular formula C17H19Cl2N3O3S and a molecular weight of 416.33 g/mol. Its IUPAC name is 1-[(4-butylphenyl)sulfonylamino]-3-(2,3-dichlorophenyl)urea.
| Compound Name | 1-[(4-butylphenyl)sulfonylamino]-3-(2,3-dichlorophenyl)urea |
|---|---|
| PubChem CID | 2954418 |
| Molecular Formula | C17H19Cl2N3O3S |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 1-[(4-butylphenyl)sulfonylamino]-3-(2,3-dichlorophenyl)urea |
| SMILES | CCCCc1ccc(S(=O)(=O)NNC(=O)Nc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C17H19Cl2N3O3S/c1-2-3-5-12-8-10-13(11-9-12)26(24,25)22-21-17(23)20-15-7-4-6-14(18)16(15)19/h4,6-11,22H,2-3,5H2,1H3,(H2,20,21,23) |
| InChIKey | CWIYDEGKHCMNCR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|