C20H22ClFN4S — CID 2955596
1-[1-(1-adamantyl)pyrazol-3-yl]-3-(3-chloro-4-fluorophenyl)thiourea (PubChem CID 2955596) has the molecular formula C20H22ClFN4S and a molecular weight of 404.94 g/mol. Its IUPAC name is 1-[1-(1-adamantyl)pyrazol-3-yl]-3-(3-chloro-4-fluorophenyl)thiourea.
| Compound Name | 1-[1-(1-adamantyl)pyrazol-3-yl]-3-(3-chloro-4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 2955596 |
| Molecular Formula | C20H22ClFN4S |
| Molecular Weight | 404.94 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 1-[1-(1-adamantyl)pyrazol-3-yl]-3-(3-chloro-4-fluorophenyl)thiourea |
| SMILES | Fc1ccc(NC(=S)Nc2ccn(C34CC5CC(CC(C5)C3)C4)n2)cc1Cl |
| InChI | InChI=1S/C20H22ClFN4S/c21-16-8-15(1-2-17(16)22)23-19(27)24-18-3-4-26(25-18)20-9-12-5-13(10-20)7-14(6-12)11-20/h1-4,8,12-14H,5-7,9-11H2,(H2,23,24,25,27) |
| InChIKey | IMLBTFSYHNWRDI-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.94 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|