About 3-cyanopropylurea
3-cyanopropylurea (PubChem CID 62667023) has the molecular formula C5H9N3O
and a molecular weight of 127.15 g/mol. Its IUPAC name is 3-cyanopropylurea.
Molecular Properties
| Compound Name | 3-cyanopropylurea |
| PubChem CID | 62667023 |
| Molecular Formula | C5H9N3O |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.07 |
| IUPAC Name | 3-cyanopropylurea |
| SMILES | N#CCCCNC(N)=O |
| InChI | InChI=1S/C5H9N3O/c6-3-1-2-4-8-5(7)9/h1-2,4H2,(H3,7,8,9) |
| InChIKey | SZTRSXCSXBCRME-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-cyanopropylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyanopropylurea?
The IUPAC name of 3-cyanopropylurea (CID 62667023) is 3-cyanopropylurea.
What is the SMILES notation for 3-cyanopropylurea?
The canonical SMILES for 3-cyanopropylurea is N#CCCCNC(N)=O.
What is the InChIKey of 3-cyanopropylurea?
The InChIKey is SZTRSXCSXBCRME-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O/c6-3-1-2-4-8-5(7)9/h1-2,4H2,(H3,7,8,9).
What are the key properties of 3-cyanopropylurea?
3-cyanopropylurea has a molecular weight of 127.15 g/mol, XLogP of -0.04, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyanopropylurea is sourced from PubChem (CID 62667023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).