C14H12O — CID 58510747
3-ethyldibenzofuran (PubChem CID 58510747) has the molecular formula C14H12O and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-ethyldibenzofuran.
| Compound Name | 3-ethyldibenzofuran |
|---|---|
| PubChem CID | 58510747 |
| Molecular Formula | C14H12O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 3-ethyldibenzofuran |
| SMILES | CCc1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C14H12O/c1-2-10-7-8-12-11-5-3-4-6-13(11)15-14(12)9-10/h3-9H,2H2,1H3 |
| InChIKey | RTFPNUOYLOUPSI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |