C18H23N3O7S — CID 3000207
[2-(4-methyl-2-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 5-oxopyrrolidine-2-carboxylate (PubChem CID 3000207) has the molecular formula C18H23N3O7S and a molecular weight of 425.46 g/mol. Its IUPAC name is [2-(4-methyl-2-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 5-oxopyrrolidine-2-carboxylate.
| Compound Name | [2-(4-methyl-2-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 3000207 |
| Molecular Formula | C18H23N3O7S |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | [2-(4-methyl-2-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 5-oxopyrrolidine-2-carboxylate |
| SMILES | Cc1ccc(NC(=O)COC(=O)C2CCC(=O)N2)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C18H23N3O7S/c1-12-2-3-13(15(10-12)29(25,26)21-6-8-27-9-7-21)19-17(23)11-28-18(24)14-4-5-16(22)20-14/h2-3,10,14H,4-9,11H2,1H3,(H,19,23)(H,20,22) |
| InChIKey | CUJMDJIWCXFRJW-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |